C11H9ClF3N5O2 — CID 133423074
5-chloro-2-nitro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]-4-(trifluoromethyl)aniline (PubChem CID 133423074) has the molecular formula C11H9ClF3N5O2 and a molecular weight of 335.67 g/mol. Its IUPAC name is 5-chloro-2-nitro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]-4-(trifluoromethyl)aniline.
| Compound Name | 5-chloro-2-nitro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 133423074 |
| Molecular Formula | C11H9ClF3N5O2 |
| Molecular Weight | 335.67 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 5-chloro-2-nitro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]-4-(trifluoromethyl)aniline |
| SMILES | CC(Nc1cc(Cl)c(C(F)(F)F)cc1[N+](=O)[O-])c1ncn[nH]1 |
| InChI | InChI=1S/C11H9ClF3N5O2/c1-5(10-16-4-17-19-10)18-8-3-7(12)6(11(13,14)15)2-9(8)20(21)22/h2-5,18H,1H3,(H,16,17,19) |
| InChIKey | HBJMVSCKHGKYBB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.67 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|