C10H9F2N5O2 — CID 103943095
2,6-difluoro-4-nitro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]aniline (PubChem CID 103943095) has the molecular formula C10H9F2N5O2 and a molecular weight of 269.21 g/mol. Its IUPAC name is 2,6-difluoro-4-nitro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]aniline.
| Compound Name | 2,6-difluoro-4-nitro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]aniline |
|---|---|
| PubChem CID | 103943095 |
| Molecular Formula | C10H9F2N5O2 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2,6-difluoro-4-nitro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]aniline |
| SMILES | CC(Nc1c(F)cc([N+](=O)[O-])cc1F)c1ncn[nH]1 |
| InChI | InChI=1S/C10H9F2N5O2/c1-5(10-13-4-14-16-10)15-9-7(11)2-6(17(18)19)3-8(9)12/h2-5,15H,1H3,(H,13,14,16) |
| InChIKey | AVWDLKFKOFCLLZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|