C10H10F2N2O2 — CID 103828733
N-but-3-en-2-yl-2,6-difluoro-4-nitroaniline (PubChem CID 103828733) has the molecular formula C10H10F2N2O2 and a molecular weight of 228.20 g/mol. Its IUPAC name is N-but-3-en-2-yl-2,6-difluoro-4-nitroaniline.
| Compound Name | N-but-3-en-2-yl-2,6-difluoro-4-nitroaniline |
|---|---|
| PubChem CID | 103828733 |
| Molecular Formula | C10H10F2N2O2 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | N-but-3-en-2-yl-2,6-difluoro-4-nitroaniline |
| SMILES | C=CC(C)Nc1c(F)cc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C10H10F2N2O2/c1-3-6(2)13-10-8(11)4-7(14(15)16)5-9(10)12/h3-6,13H,1H2,2H3 |
| InChIKey | DYNIIRAVIFBNFI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|