C14H20F2N2O2 — CID 106026448
2,6-difluoro-4-nitro-N-octan-4-ylaniline (PubChem CID 106026448) has the molecular formula C14H20F2N2O2 and a molecular weight of 286.32 g/mol. Its IUPAC name is 2,6-difluoro-4-nitro-N-octan-4-ylaniline.
| Compound Name | 2,6-difluoro-4-nitro-N-octan-4-ylaniline |
|---|---|
| PubChem CID | 106026448 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2,6-difluoro-4-nitro-N-octan-4-ylaniline |
| SMILES | CCCCC(CCC)Nc1c(F)cc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C14H20F2N2O2/c1-3-5-7-10(6-4-2)17-14-12(15)8-11(18(19)20)9-13(14)16/h8-10,17H,3-7H2,1-2H3 |
| InChIKey | MALBYHJEWCIZHI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|