C9H10BrFN2O4 — CID 71996045
2-(2-bromo-6-fluoro-4-nitroanilino)propane-1,3-diol (PubChem CID 71996045) has the molecular formula C9H10BrFN2O4 and a molecular weight of 309.09 g/mol. Its IUPAC name is 2-(2-bromo-6-fluoro-4-nitroanilino)propane-1,3-diol.
| Compound Name | 2-(2-bromo-6-fluoro-4-nitroanilino)propane-1,3-diol |
|---|---|
| PubChem CID | 71996045 |
| Molecular Formula | C9H10BrFN2O4 |
| Molecular Weight | 309.09 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | 2-(2-bromo-6-fluoro-4-nitroanilino)propane-1,3-diol |
| SMILES | O=[N+]([O-])c1cc(F)c(NC(CO)CO)c(Br)c1 |
| InChI | InChI=1S/C9H10BrFN2O4/c10-7-1-6(13(16)17)2-8(11)9(7)12-5(3-14)4-15/h1-2,5,12,14-15H,3-4H2 |
| InChIKey | PYUZUUMANWMEDM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.09 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|