(2S)-2-(2,6-difluoro-4-nitroanilino)-3-methylbutanoic acid

C11H12F2N2O4 — CID 120964334

IUPAC(2S)-2-(2,6-difluoro-4-nitroanilino)-3-methylbutanoic acid
SMILESCC(C)[C@H](Nc1c(F)cc([N+](=O)[O-])cc1F)C(=O)O
InChIInChI=1S/C11H12F2N2O4/c1-5(2)9(11(16)17)14-10-7(12)3-6(15(18)19)4-8(10)13/h3-5,9,14H,1-2H3,(H,16,17)/t9-/m0/s1
InChIKeyOACGFXYLZJKJMD-VIFPVBQESA-N
MW274.22 g/mol
LogP2.39
Rot. Bonds5

About (2S)-2-(2,6-difluoro-4-nitroanilino)-3-methylbutanoic acid

(2S)-2-(2,6-difluoro-4-nitroanilino)-3-methylbutanoic acid (PubChem CID 120964334) has the molecular formula C11H12F2N2O4 and a molecular weight of 274.22 g/mol. Its IUPAC name is (2S)-2-(2,6-difluoro-4-nitroanilino)-3-methylbutanoic acid.

Molecular Properties

Compound Name(2S)-2-(2,6-difluoro-4-nitroanilino)-3-methylbutanoic acid
PubChem CID120964334
Molecular FormulaC11H12F2N2O4
Molecular Weight274.22 g/mol
Exact Mass274.08
IUPAC Name(2S)-2-(2,6-difluoro-4-nitroanilino)-3-methylbutanoic acid
SMILESCC(C)[C@H](Nc1c(F)cc([N+](=O)[O-])cc1F)C(=O)O
InChIInChI=1S/C11H12F2N2O4/c1-5(2)9(11(16)17)14-10-7(12)3-6(15(18)19)4-8(10)13/h3-5,9,14H,1-2H3,(H,16,17)/t9-/m0/s1
InChIKeyOACGFXYLZJKJMD-VIFPVBQESA-N
XLogP2.39
TPSA92.47 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.22
LogP ≤ 52.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2S)-2-(2,6-difluoro-4-nitroanilino)-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-(2,6-difluoro-4-nitroanilino)-3-methylbutanoic acid?
The IUPAC name of (2S)-2-(2,6-difluoro-4-nitroanilino)-3-methylbutanoic acid (CID 120964334) is (2S)-2-(2,6-difluoro-4-nitroanilino)-3-methylbutanoic acid.
What is the SMILES notation for (2S)-2-(2,6-difluoro-4-nitroanilino)-3-methylbutanoic acid?
The canonical SMILES for (2S)-2-(2,6-difluoro-4-nitroanilino)-3-methylbutanoic acid is CC(C)[C@H](Nc1c(F)cc([N+](=O)[O-])cc1F)C(=O)O.
What is the InChIKey of (2S)-2-(2,6-difluoro-4-nitroanilino)-3-methylbutanoic acid?
The InChIKey is OACGFXYLZJKJMD-VIFPVBQESA-N. The full InChI is InChI=1S/C11H12F2N2O4/c1-5(2)9(11(16)17)14-10-7(12)3-6(15(18)19)4-8(10)13/h3-5,9,14H,1-2H3,(H,16,17)/t9-/m0/s1.
What are the key properties of (2S)-2-(2,6-difluoro-4-nitroanilino)-3-methylbutanoic acid?
(2S)-2-(2,6-difluoro-4-nitroanilino)-3-methylbutanoic acid has a molecular weight of 274.22 g/mol, XLogP of 2.39, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(2,6-difluoro-4-nitroanilino)-3-methylbutanoic acid is sourced from PubChem (CID 120964334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).