C11H12N4O8 — CID 71355743
(2S)-3-methyl-2-(2,4,6-trinitroanilino)butanoic acid (PubChem CID 71355743) has the molecular formula C11H12N4O8 and a molecular weight of 328.24 g/mol. Its IUPAC name is (2S)-3-methyl-2-(2,4,6-trinitroanilino)butanoic acid.
| Compound Name | (2S)-3-methyl-2-(2,4,6-trinitroanilino)butanoic acid |
|---|---|
| PubChem CID | 71355743 |
| Molecular Formula | C11H12N4O8 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | (2S)-3-methyl-2-(2,4,6-trinitroanilino)butanoic acid |
| SMILES | CC(C)[C@H](Nc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C11H12N4O8/c1-5(2)9(11(16)17)12-10-7(14(20)21)3-6(13(18)19)4-8(10)15(22)23/h3-5,9,12H,1-2H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | MYCVCHKLMYUEAZ-VIFPVBQESA-N |
| XLogP | 1.93 |
| TPSA | 178.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|