C22H24N6O12 — CID 71354293
(2S)-2-hydroxy-2-[[(2S)-2-[[(2R)-3-(4-hydroxyphenyl)-2-(2,4,6-trinitroanilino)propanoyl]amino]-3-methylbutanoyl]amino]acetic acid (PubChem CID 71354293) has the molecular formula C22H24N6O12 and a molecular weight of 564.46 g/mol. Its IUPAC name is (2S)-2-hydroxy-2-[[(2S)-2-[[(2R)-3-(4-hydroxyphenyl)-2-(2,4,6-trinitroanilino)propanoyl]amino]-3-methylbutanoyl]amino]acetic acid.
| Compound Name | (2S)-2-hydroxy-2-[[(2S)-2-[[(2R)-3-(4-hydroxyphenyl)-2-(2,4,6-trinitroanilino)propanoyl]amino]-3-methylbutanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 71354293 |
| Molecular Formula | C22H24N6O12 |
| Molecular Weight | 564.46 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | (2S)-2-hydroxy-2-[[(2S)-2-[[(2R)-3-(4-hydroxyphenyl)-2-(2,4,6-trinitroanilino)propanoyl]amino]-3-methylbutanoyl]amino]acetic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](Cc1ccc(O)cc1)Nc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)N[C@@H](O)C(=O)O |
| InChI | InChI=1S/C22H24N6O12/c1-10(2)17(20(31)25-21(32)22(33)34)24-19(30)14(7-11-3-5-13(29)6-4-11)23-18-15(27(37)38)8-12(26(35)36)9-16(18)28(39)40/h3-6,8-10,14,17,21,23,29,32H,7H2,1-2H3,(H,24,30)(H,25,31)(H,33,34)/t14-,17+,21+/m1/s1 |
| InChIKey | RFRCJUIQRJTQAP-FNXXIHLHSA-N |
| XLogP | 0.80 |
| TPSA | 277.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.46 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|