C19H22N4O7 — CID 7100576
(2R)-2-[[6-[[(1R)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-3-nitro-2-pyridinyl]amino]-3-methylbutanoic acid (PubChem CID 7100576) has the molecular formula C19H22N4O7 and a molecular weight of 418.41 g/mol. Its IUPAC name is (2R)-2-[[6-[[(1R)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-3-nitro-2-pyridinyl]amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[6-[[(1R)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-3-nitro-2-pyridinyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 7100576 |
| Molecular Formula | C19H22N4O7 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (2R)-2-[[6-[[(1R)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-3-nitro-2-pyridinyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](Nc1nc(N[C@H](Cc2ccc(O)cc2)C(=O)O)ccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C19H22N4O7/c1-10(2)16(19(27)28)22-17-14(23(29)30)7-8-15(21-17)20-13(18(25)26)9-11-3-5-12(24)6-4-11/h3-8,10,13,16,24H,9H2,1-2H3,(H,25,26)(H,27,28)(H2,20,21,22)/t13-,16-/m1/s1 |
| InChIKey | HQDRVMYJPUDNJF-CZUORRHYSA-N |
| XLogP | 2.32 |
| TPSA | 174.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|