C19H16ClN5O5 — CID 68580617
2-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 68580617) has the molecular formula C19H16ClN5O5 and a molecular weight of 429.82 g/mol. Its IUPAC name is 2-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 68580617 |
| Molecular Formula | C19H16ClN5O5 |
| Molecular Weight | 429.82 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 2-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(O)cc1)Nc1nc(Nc2ccc(Cl)cc2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16ClN5O5/c20-12-3-5-13(6-4-12)22-19-21-10-16(25(29)30)17(24-19)23-15(18(27)28)9-11-1-7-14(26)8-2-11/h1-8,10,15,26H,9H2,(H,27,28)(H2,21,22,23,24) |
| InChIKey | JVZZFVQMOAIRPS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 150.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.82 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|