C23H22ClN5O4 — CID 21080929
4-[2-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]-2,3-dihydro-1H-inden-5-yl]butanoic acid (PubChem CID 21080929) has the molecular formula C23H22ClN5O4 and a molecular weight of 467.91 g/mol. Its IUPAC name is 4-[2-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]-2,3-dihydro-1H-inden-5-yl]butanoic acid.
| Compound Name | 4-[2-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]-2,3-dihydro-1H-inden-5-yl]butanoic acid |
|---|---|
| PubChem CID | 21080929 |
| Molecular Formula | C23H22ClN5O4 |
| Molecular Weight | 467.91 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 4-[2-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]-2,3-dihydro-1H-inden-5-yl]butanoic acid |
| SMILES | O=C(O)CCCc1ccc2c(c1)CC(Nc1nc(Nc3ccc(Cl)cc3)ncc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C23H22ClN5O4/c24-17-6-8-18(9-7-17)27-23-25-13-20(29(32)33)22(28-23)26-19-11-15-5-4-14(10-16(15)12-19)2-1-3-21(30)31/h4-10,13,19H,1-3,11-12H2,(H,30,31)(H2,25,26,27,28) |
| InChIKey | DDCUMEMCASLZJE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.91 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|