C12H10ClN5O4 — CID 21077545
2-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]acetic acid (PubChem CID 21077545) has the molecular formula C12H10ClN5O4 and a molecular weight of 323.70 g/mol. Its IUPAC name is 2-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]acetic acid.
| Compound Name | 2-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 21077545 |
| Molecular Formula | C12H10ClN5O4 |
| Molecular Weight | 323.70 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 2-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]acetic acid |
| SMILES | O=C(O)CNc1nc(Nc2ccc(Cl)cc2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10ClN5O4/c13-7-1-3-8(4-2-7)16-12-15-5-9(18(21)22)11(17-12)14-6-10(19)20/h1-5H,6H2,(H,19,20)(H2,14,15,16,17) |
| InChIKey | CIXPWNMIMRYDKU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.70 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|