C12H12ClN7O2 — CID 67210652
2-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]ethanimidamide (PubChem CID 67210652) has the molecular formula C12H12ClN7O2 and a molecular weight of 321.73 g/mol. Its IUPAC name is 2-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]ethanimidamide.
| Compound Name | 2-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]ethanimidamide |
|---|---|
| PubChem CID | 67210652 |
| Molecular Formula | C12H12ClN7O2 |
| Molecular Weight | 321.73 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]ethanimidamide |
| SMILES | [H]/N=C(\N)CNc1nc(Nc2ccc(Cl)cc2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12ClN7O2/c13-7-1-3-8(4-2-7)18-12-17-5-9(20(21)22)11(19-12)16-6-10(14)15/h1-5H,6H2,(H3,14,15)(H2,16,17,18,19) |
| InChIKey | VRZMIUWTXKREPB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 142.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.73 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|