C14H17ClN6O2 — CID 21077540
4-N-(4-aminobutyl)-2-N-(4-chlorophenyl)-5-nitropyrimidine-2,4-diamine (PubChem CID 21077540) has the molecular formula C14H17ClN6O2 and a molecular weight of 336.78 g/mol. Its IUPAC name is 4-N-(4-aminobutyl)-2-N-(4-chlorophenyl)-5-nitropyrimidine-2,4-diamine.
| Compound Name | 4-N-(4-aminobutyl)-2-N-(4-chlorophenyl)-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 21077540 |
| Molecular Formula | C14H17ClN6O2 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 4-N-(4-aminobutyl)-2-N-(4-chlorophenyl)-5-nitropyrimidine-2,4-diamine |
| SMILES | NCCCCNc1nc(Nc2ccc(Cl)cc2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17ClN6O2/c15-10-3-5-11(6-4-10)19-14-18-9-12(21(22)23)13(20-14)17-8-2-1-7-16/h3-6,9H,1-2,7-8,16H2,(H2,17,18,19,20) |
| InChIKey | JHODZBRXWJRVJW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|