C12H13ClN6O2 — CID 21077470
2-N-[3-(aminomethyl)-4-chlorophenyl]-4-N-methyl-5-nitropyrimidine-2,4-diamine (PubChem CID 21077470) has the molecular formula C12H13ClN6O2 and a molecular weight of 308.73 g/mol. Its IUPAC name is 2-N-[3-(aminomethyl)-4-chlorophenyl]-4-N-methyl-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-(aminomethyl)-4-chlorophenyl]-4-N-methyl-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 21077470 |
| Molecular Formula | C12H13ClN6O2 |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-N-[3-(aminomethyl)-4-chlorophenyl]-4-N-methyl-5-nitropyrimidine-2,4-diamine |
| SMILES | CNc1nc(Nc2ccc(Cl)c(CN)c2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13ClN6O2/c1-15-11-10(19(20)21)6-16-12(18-11)17-8-2-3-9(13)7(4-8)5-14/h2-4,6H,5,14H2,1H3,(H2,15,16,17,18) |
| InChIKey | UALACJPKYUGBMU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|