C13H15ClN6O4S — CID 21077484
N-[[2-chloro-5-[[4-(methylamino)-5-nitropyrimidin-2-yl]amino]phenyl]methyl]methanesulfonamide (PubChem CID 21077484) has the molecular formula C13H15ClN6O4S and a molecular weight of 386.82 g/mol. Its IUPAC name is N-[[2-chloro-5-[[4-(methylamino)-5-nitropyrimidin-2-yl]amino]phenyl]methyl]methanesulfonamide.
| Compound Name | N-[[2-chloro-5-[[4-(methylamino)-5-nitropyrimidin-2-yl]amino]phenyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 21077484 |
| Molecular Formula | C13H15ClN6O4S |
| Molecular Weight | 386.82 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N-[[2-chloro-5-[[4-(methylamino)-5-nitropyrimidin-2-yl]amino]phenyl]methyl]methanesulfonamide |
| SMILES | CNc1nc(Nc2ccc(Cl)c(CNS(C)(=O)=O)c2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15ClN6O4S/c1-15-12-11(20(21)22)7-16-13(19-12)18-9-3-4-10(14)8(5-9)6-17-25(2,23)24/h3-5,7,17H,6H2,1-2H3,(H2,15,16,18,19) |
| InChIKey | LGYGAOFMDJMIGH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.82 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|