C13H16Cl2N5OP — CID 21077439
2-N-(3,4-dichlorophenyl)-5-N-dimethylphosphoryl-4-N-methylpyrimidine-2,4,5-triamine (PubChem CID 21077439) has the molecular formula C13H16Cl2N5OP and a molecular weight of 360.19 g/mol. Its IUPAC name is 2-N-(3,4-dichlorophenyl)-5-N-dimethylphosphoryl-4-N-methylpyrimidine-2,4,5-triamine.
| Compound Name | 2-N-(3,4-dichlorophenyl)-5-N-dimethylphosphoryl-4-N-methylpyrimidine-2,4,5-triamine |
|---|---|
| PubChem CID | 21077439 |
| Molecular Formula | C13H16Cl2N5OP |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 2-N-(3,4-dichlorophenyl)-5-N-dimethylphosphoryl-4-N-methylpyrimidine-2,4,5-triamine |
| SMILES | CNc1nc(Nc2ccc(Cl)c(Cl)c2)ncc1NP(C)(C)=O |
| InChI | InChI=1S/C13H16Cl2N5OP/c1-16-12-11(20-22(2,3)21)7-17-13(19-12)18-8-4-5-9(14)10(15)6-8/h4-7H,1-3H3,(H,20,21)(H2,16,17,18,19) |
| InChIKey | FJIIDZOMQVMEKD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|