C8H9Cl2NO — CID 153392117
3,4-dichloro-N-methylaniline;formaldehyde (PubChem CID 153392117) has the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. Its IUPAC name is 3,4-dichloro-N-methylaniline;formaldehyde.
| Compound Name | 3,4-dichloro-N-methylaniline;formaldehyde |
|---|---|
| PubChem CID | 153392117 |
| Molecular Formula | C8H9Cl2NO |
| Molecular Weight | 206.07 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | 3,4-dichloro-N-methylaniline;formaldehyde |
| SMILES | C=O.CNc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C7H7Cl2N.CH2O/c1-10-5-2-3-6(8)7(9)4-5;1-2/h2-4,10H,1H3;1H2 |
| InChIKey | YOGXOFDGNVOOIR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.07 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |