C13H11Cl2N3O2 — CID 80768908
3-N-(3,4-dichlorophenyl)-1-N-methyl-5-nitrobenzene-1,3-diamine (PubChem CID 80768908) has the molecular formula C13H11Cl2N3O2 and a molecular weight of 312.16 g/mol. Its IUPAC name is 3-N-(3,4-dichlorophenyl)-1-N-methyl-5-nitrobenzene-1,3-diamine.
| Compound Name | 3-N-(3,4-dichlorophenyl)-1-N-methyl-5-nitrobenzene-1,3-diamine |
|---|---|
| PubChem CID | 80768908 |
| Molecular Formula | C13H11Cl2N3O2 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 3-N-(3,4-dichlorophenyl)-1-N-methyl-5-nitrobenzene-1,3-diamine |
| SMILES | CNc1cc(Nc2ccc(Cl)c(Cl)c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H11Cl2N3O2/c1-16-9-4-10(6-11(5-9)18(19)20)17-8-2-3-12(14)13(15)7-8/h2-7,16-17H,1H3 |
| InChIKey | OQHRMLNJKWSPMH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|