C12H11Cl2N3 — CID 113423614
5-N-(3,4-dichlorophenyl)-3-N-methylpyridine-3,5-diamine (PubChem CID 113423614) has the molecular formula C12H11Cl2N3 and a molecular weight of 268.15 g/mol. Its IUPAC name is 5-N-(3,4-dichlorophenyl)-3-N-methylpyridine-3,5-diamine.
| Compound Name | 5-N-(3,4-dichlorophenyl)-3-N-methylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 113423614 |
| Molecular Formula | C12H11Cl2N3 |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 5-N-(3,4-dichlorophenyl)-3-N-methylpyridine-3,5-diamine |
| SMILES | CNc1cncc(Nc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C12H11Cl2N3/c1-15-9-4-10(7-16-6-9)17-8-2-3-11(13)12(14)5-8/h2-7,15,17H,1H3 |
| InChIKey | KTDQIMDPRMDCGM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |