C12H12ClN3 — CID 104532340
5-N-(3-chlorophenyl)-3-N-methylpyridine-3,5-diamine (PubChem CID 104532340) has the molecular formula C12H12ClN3 and a molecular weight of 233.70 g/mol. Its IUPAC name is 5-N-(3-chlorophenyl)-3-N-methylpyridine-3,5-diamine.
| Compound Name | 5-N-(3-chlorophenyl)-3-N-methylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 104532340 |
| Molecular Formula | C12H12ClN3 |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 5-N-(3-chlorophenyl)-3-N-methylpyridine-3,5-diamine |
| SMILES | CNc1cncc(Nc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C12H12ClN3/c1-14-11-6-12(8-15-7-11)16-10-4-2-3-9(13)5-10/h2-8,14,16H,1H3 |
| InChIKey | YYCJNPPTPLMHFB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |