C12H12BrN3 — CID 104532356
5-N-(2-bromophenyl)-3-N-methylpyridine-3,5-diamine (PubChem CID 104532356) has the molecular formula C12H12BrN3 and a molecular weight of 278.15 g/mol. Its IUPAC name is 5-N-(2-bromophenyl)-3-N-methylpyridine-3,5-diamine.
| Compound Name | 5-N-(2-bromophenyl)-3-N-methylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 104532356 |
| Molecular Formula | C12H12BrN3 |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 5-N-(2-bromophenyl)-3-N-methylpyridine-3,5-diamine |
| SMILES | CNc1cncc(Nc2ccccc2Br)c1 |
| InChI | InChI=1S/C12H12BrN3/c1-14-9-6-10(8-15-7-9)16-12-5-3-2-4-11(12)13/h2-8,14,16H,1H3 |
| InChIKey | CNZJYRODUNKAAR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |