C13H14BrN3O — CID 113424113
5-N-(3-bromo-4-methoxyphenyl)-3-N-methylpyridine-3,5-diamine (PubChem CID 113424113) has the molecular formula C13H14BrN3O and a molecular weight of 308.18 g/mol. Its IUPAC name is 5-N-(3-bromo-4-methoxyphenyl)-3-N-methylpyridine-3,5-diamine.
| Compound Name | 5-N-(3-bromo-4-methoxyphenyl)-3-N-methylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 113424113 |
| Molecular Formula | C13H14BrN3O |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 5-N-(3-bromo-4-methoxyphenyl)-3-N-methylpyridine-3,5-diamine |
| SMILES | CNc1cncc(Nc2ccc(OC)c(Br)c2)c1 |
| InChI | InChI=1S/C13H14BrN3O/c1-15-10-5-11(8-16-7-10)17-9-3-4-13(18-2)12(14)6-9/h3-8,15,17H,1-2H3 |
| InChIKey | JSGATKUNBYXVMJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |