C14H17N3 — CID 104532337
5-N-(2,4-dimethylphenyl)-3-N-methylpyridine-3,5-diamine (PubChem CID 104532337) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 5-N-(2,4-dimethylphenyl)-3-N-methylpyridine-3,5-diamine.
| Compound Name | 5-N-(2,4-dimethylphenyl)-3-N-methylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 104532337 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 5-N-(2,4-dimethylphenyl)-3-N-methylpyridine-3,5-diamine |
| SMILES | CNc1cncc(Nc2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C14H17N3/c1-10-4-5-14(11(2)6-10)17-13-7-12(15-3)8-16-9-13/h4-9,15,17H,1-3H3 |
| InChIKey | NOADOJDXYPDIGK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |