C9H14ClN — CID 18686602
N,2,4-trimethylaniline;hydrochloride (PubChem CID 18686602) has the molecular formula C9H14ClN and a molecular weight of 171.67 g/mol. Its IUPAC name is N,2,4-trimethylaniline;hydrochloride.
| Compound Name | N,2,4-trimethylaniline;hydrochloride |
|---|---|
| PubChem CID | 18686602 |
| Molecular Formula | C9H14ClN |
| Molecular Weight | 171.67 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | N,2,4-trimethylaniline;hydrochloride |
| SMILES | CNc1ccc(C)cc1C.Cl |
| InChI | InChI=1S/C9H13N.ClH/c1-7-4-5-9(10-3)8(2)6-7;/h4-6,10H,1-3H3;1H |
| InChIKey | XCAXAYBCNDWTTL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.67 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |