C8H13N3 — CID 149056718
2-hydrazinyl-N,5-dimethylaniline (PubChem CID 149056718) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-hydrazinyl-N,5-dimethylaniline.
| Compound Name | 2-hydrazinyl-N,5-dimethylaniline |
|---|---|
| PubChem CID | 149056718 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 2-hydrazinyl-N,5-dimethylaniline |
| SMILES | CNc1cc(C)ccc1NN |
| InChI | InChI=1S/C8H13N3/c1-6-3-4-7(11-9)8(5-6)10-2/h3-5,10-11H,9H2,1-2H3 |
| InChIKey | QKZDPUJWLXIPLR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|