C16H26N6 — CID 155700978
1-N,4-dimethylbenzene-1,2-diamine;2-hydrazinyl-5-methylaniline;methanimine (PubChem CID 155700978) has the molecular formula C16H26N6 and a molecular weight of 302.43 g/mol. Its IUPAC name is 1-N,4-dimethylbenzene-1,2-diamine;2-hydrazinyl-5-methylaniline;methanimine.
| Compound Name | 1-N,4-dimethylbenzene-1,2-diamine;2-hydrazinyl-5-methylaniline;methanimine |
|---|---|
| PubChem CID | 155700978 |
| Molecular Formula | C16H26N6 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 1-N,4-dimethylbenzene-1,2-diamine;2-hydrazinyl-5-methylaniline;methanimine |
| SMILES | CNc1ccc(C)cc1N.Cc1ccc(NN)c(N)c1.[H]N=C |
| InChI | InChI=1S/C8H12N2.C7H11N3.CH3N/c1-6-3-4-8(10-2)7(9)5-6;1-5-2-3-7(10-9)6(8)4-5;1-2/h3-5,10H,9H2,1-2H3;2-4,10H,8-9H2,1H3;2H,1H2 |
| InChIKey | BWACLFQSBIRRCS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 125.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|