C9H12ClNO — CID 177231502
2-chloro-N,4-dimethylaniline;formaldehyde (PubChem CID 177231502) has the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. Its IUPAC name is 2-chloro-N,4-dimethylaniline;formaldehyde.
| Compound Name | 2-chloro-N,4-dimethylaniline;formaldehyde |
|---|---|
| PubChem CID | 177231502 |
| Molecular Formula | C9H12ClNO |
| Molecular Weight | 185.65 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 2-chloro-N,4-dimethylaniline;formaldehyde |
| SMILES | C=O.CNc1ccc(C)cc1Cl |
| InChI | InChI=1S/C8H10ClN.CH2O/c1-6-3-4-8(10-2)7(9)5-6;1-2/h3-5,10H,1-2H3;1H2 |
| InChIKey | KPQDSAYQHVALKC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.65 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |