C13H13ClN2O2 — CID 58230223
1-(2-chloro-4-methylanilino)-3,4-dimethylpyrrole-2,5-dione (PubChem CID 58230223) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is 1-(2-chloro-4-methylanilino)-3,4-dimethylpyrrole-2,5-dione.
| Compound Name | 1-(2-chloro-4-methylanilino)-3,4-dimethylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 58230223 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 1-(2-chloro-4-methylanilino)-3,4-dimethylpyrrole-2,5-dione |
| SMILES | CC1=C(C)C(=O)N(Nc2ccc(C)cc2Cl)C1=O |
| InChI | InChI=1S/C13H13ClN2O2/c1-7-4-5-11(10(14)6-7)15-16-12(17)8(2)9(3)13(16)18/h4-6,15H,1-3H3 |
| InChIKey | JAELIOTUJLDXOA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|