C16H12ClN3O2S — CID 12881218
1-(2-chloro-4-methylphenyl)-3-(1,3-dioxoisoindol-2-yl)thiourea (PubChem CID 12881218) has the molecular formula C16H12ClN3O2S and a molecular weight of 345.81 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-3-(1,3-dioxoisoindol-2-yl)thiourea.
| Compound Name | 1-(2-chloro-4-methylphenyl)-3-(1,3-dioxoisoindol-2-yl)thiourea |
|---|---|
| PubChem CID | 12881218 |
| Molecular Formula | C16H12ClN3O2S |
| Molecular Weight | 345.81 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-3-(1,3-dioxoisoindol-2-yl)thiourea |
| SMILES | Cc1ccc(NC(=S)NN2C(=O)c3ccccc3C2=O)c(Cl)c1 |
| InChI | InChI=1S/C16H12ClN3O2S/c1-9-6-7-13(12(17)8-9)18-16(23)19-20-14(21)10-4-2-3-5-11(10)15(20)22/h2-8H,1H3,(H2,18,19,23) |
| InChIKey | SMPOEZKOBNJYBU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.81 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|