C9H14N2S — CID 144983496
1-N-methyl-4-[methyl(methylidene)-λ4-sulfanyl]benzene-1,2-diamine (PubChem CID 144983496) has the molecular formula C9H14N2S and a molecular weight of 182.29 g/mol. Its IUPAC name is 1-N-methyl-4-[methyl(methylidene)-λ4-sulfanyl]benzene-1,2-diamine.
| Compound Name | 1-N-methyl-4-[methyl(methylidene)-λ4-sulfanyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 144983496 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 1-N-methyl-4-[methyl(methylidene)-λ4-sulfanyl]benzene-1,2-diamine |
| SMILES | C=S(C)c1ccc(NC)c(N)c1 |
| InChI | InChI=1S/C9H14N2S/c1-11-9-5-4-7(12(2)3)6-8(9)10/h4-6,11H,2,10H2,1,3H3 |
| InChIKey | PEFQNIYJFGKITJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|