C8H10Cl2N2O2S — CID 13403122
4-(dichloromethylsulfonyl)-1-N-methylbenzene-1,2-diamine (PubChem CID 13403122) has the molecular formula C8H10Cl2N2O2S and a molecular weight of 269.15 g/mol. Its IUPAC name is 4-(dichloromethylsulfonyl)-1-N-methylbenzene-1,2-diamine.
| Compound Name | 4-(dichloromethylsulfonyl)-1-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 13403122 |
| Molecular Formula | C8H10Cl2N2O2S |
| Molecular Weight | 269.15 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | 4-(dichloromethylsulfonyl)-1-N-methylbenzene-1,2-diamine |
| SMILES | CNc1ccc(S(=O)(=O)C(Cl)Cl)cc1N |
| InChI | InChI=1S/C8H10Cl2N2O2S/c1-12-7-3-2-5(4-6(7)11)15(13,14)8(9)10/h2-4,8,12H,11H2,1H3 |
| InChIKey | ODNBZCILNMUOHP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.15 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|