About ethane;2-N-methylbenzene-1,2-diamine
ethane;2-N-methylbenzene-1,2-diamine (PubChem CID 91146948) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is ethane;2-N-methylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | ethane;2-N-methylbenzene-1,2-diamine |
| PubChem CID | 91146948 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | ethane;2-N-methylbenzene-1,2-diamine |
| SMILES | CC.CC.CNc1ccccc1N |
| InChI | InChI=1S/C7H10N2.2C2H6/c1-9-7-5-3-2-4-6(7)8;2*1-2/h2-5,9H,8H2,1H3;2*1-2H3 |
| InChIKey | OTRBNTHFGAOZDU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-N-methylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-N-methylbenzene-1,2-diamine?
The IUPAC name of ethane;2-N-methylbenzene-1,2-diamine (CID 91146948) is ethane;2-N-methylbenzene-1,2-diamine.
What is the SMILES notation for ethane;2-N-methylbenzene-1,2-diamine?
The canonical SMILES for ethane;2-N-methylbenzene-1,2-diamine is CC.CC.CNc1ccccc1N.
What is the InChIKey of ethane;2-N-methylbenzene-1,2-diamine?
The InChIKey is OTRBNTHFGAOZDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.2C2H6/c1-9-7-5-3-2-4-6(7)8;2*1-2/h2-5,9H,8H2,1H3;2*1-2H3.
What are the key properties of ethane;2-N-methylbenzene-1,2-diamine?
ethane;2-N-methylbenzene-1,2-diamine has a molecular weight of 182.31 g/mol, XLogP of 3.36, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-N-methylbenzene-1,2-diamine is sourced from PubChem (CID 91146948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).