C11H22N2 — CID 91146948
ethane;2-N-methylbenzene-1,2-diamine (PubChem CID 91146948) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is ethane;2-N-methylbenzene-1,2-diamine.
| Compound Name | ethane;2-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 91146948 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | ethane;2-N-methylbenzene-1,2-diamine |
| SMILES | CC.CC.CNc1ccccc1N |
| InChI | InChI=1S/C7H10N2.2C2H6/c1-9-7-5-3-2-4-6(7)8;2*1-2/h2-5,9H,8H2,1H3;2*1-2H3 |
| InChIKey | OTRBNTHFGAOZDU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|