C7H13N2P — CID 143707966
methane;2-N-phosphanylbenzene-1,2-diamine (PubChem CID 143707966) has the molecular formula C7H13N2P and a molecular weight of 156.17 g/mol. Its IUPAC name is methane;2-N-phosphanylbenzene-1,2-diamine.
| Compound Name | methane;2-N-phosphanylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 143707966 |
| Molecular Formula | C7H13N2P |
| Molecular Weight | 156.17 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | methane;2-N-phosphanylbenzene-1,2-diamine |
| SMILES | C.Nc1ccccc1NP |
| InChI | InChI=1S/C6H9N2P.CH4/c7-5-3-1-2-4-6(5)8-9;/h1-4,8H,7,9H2;1H4 |
| InChIKey | NCFQQZVXDWDOTH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.17 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|