C6H7N2S- — CID 171097854
2-N-sulfidobenzene-1,2-diamine (PubChem CID 171097854) has the molecular formula C6H7N2S- and a molecular weight of 139.20 g/mol. Its IUPAC name is 2-N-sulfidobenzene-1,2-diamine.
| Compound Name | 2-N-sulfidobenzene-1,2-diamine |
|---|---|
| PubChem CID | 171097854 |
| Molecular Formula | C6H7N2S- |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.03 |
| IUPAC Name | 2-N-sulfidobenzene-1,2-diamine |
| SMILES | Nc1ccccc1N[S-] |
| InChI | InChI=1S/C6H7N2S/c7-5-3-1-2-4-6(5)8-9/h1-4,8H,7H2/q-1 |
| InChIKey | TZXGELATAIZSOH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|