C10H19N2P — CID 143333934
2-N-dimethylphosphanylbenzene-1,2-diamine;ethane (PubChem CID 143333934) has the molecular formula C10H19N2P and a molecular weight of 198.25 g/mol. Its IUPAC name is 2-N-dimethylphosphanylbenzene-1,2-diamine;ethane.
| Compound Name | 2-N-dimethylphosphanylbenzene-1,2-diamine;ethane |
|---|---|
| PubChem CID | 143333934 |
| Molecular Formula | C10H19N2P |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 2-N-dimethylphosphanylbenzene-1,2-diamine;ethane |
| SMILES | CC.CP(C)Nc1ccccc1N |
| InChI | InChI=1S/C8H13N2P.C2H6/c1-11(2)10-8-6-4-3-5-7(8)9;1-2/h3-6,10H,9H2,1-2H3;1-2H3 |
| InChIKey | VIGUTMXYXJCCAA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|