About benzene-1,2-diamine;N-methylmethanamine
benzene-1,2-diamine;N-methylmethanamine (PubChem CID 174458514) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is benzene-1,2-diamine;N-methylmethanamine.
Molecular Properties
| Compound Name | benzene-1,2-diamine;N-methylmethanamine |
| PubChem CID | 174458514 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | benzene-1,2-diamine;N-methylmethanamine |
| SMILES | CNC.Nc1ccccc1N |
| InChI | InChI=1S/C6H8N2.C2H7N/c7-5-3-1-2-4-6(5)8;1-3-2/h1-4H,7-8H2;3H,1-2H3 |
| InChIKey | UKKLWUHAWUUWBA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diamine;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diamine;N-methylmethanamine?
The IUPAC name of benzene-1,2-diamine;N-methylmethanamine (CID 174458514) is benzene-1,2-diamine;N-methylmethanamine.
What is the SMILES notation for benzene-1,2-diamine;N-methylmethanamine?
The canonical SMILES for benzene-1,2-diamine;N-methylmethanamine is CNC.Nc1ccccc1N.
What is the InChIKey of benzene-1,2-diamine;N-methylmethanamine?
The InChIKey is UKKLWUHAWUUWBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.C2H7N/c7-5-3-1-2-4-6(5)8;1-3-2/h1-4H,7-8H2;3H,1-2H3.
What are the key properties of benzene-1,2-diamine;N-methylmethanamine?
benzene-1,2-diamine;N-methylmethanamine has a molecular weight of 153.23 g/mol, XLogP of 0.69, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diamine;N-methylmethanamine is sourced from PubChem (CID 174458514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).