About benzene-1,2-diamine;hydrogen peroxide;hydrochloride
benzene-1,2-diamine;hydrogen peroxide;hydrochloride (PubChem CID 175004407) has the molecular formula C6H11ClN2O2
and a molecular weight of 178.62 g/mol. Its IUPAC name is benzene-1,2-diamine;hydrogen peroxide;hydrochloride.
Molecular Properties
| Compound Name | benzene-1,2-diamine;hydrogen peroxide;hydrochloride |
| PubChem CID | 175004407 |
| Molecular Formula | C6H11ClN2O2 |
| Molecular Weight | 178.62 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | benzene-1,2-diamine;hydrogen peroxide;hydrochloride |
| SMILES | Cl.Nc1ccccc1N.OO |
| InChI | InChI=1S/C6H8N2.ClH.H2O2/c7-5-3-1-2-4-6(5)8;;1-2/h1-4H,7-8H2;1H;1-2H |
| InChIKey | XGAIUKFSSBMYFQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.62 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diamine;hydrogen peroxide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diamine;hydrogen peroxide;hydrochloride?
The IUPAC name of benzene-1,2-diamine;hydrogen peroxide;hydrochloride (CID 175004407) is benzene-1,2-diamine;hydrogen peroxide;hydrochloride.
What is the SMILES notation for benzene-1,2-diamine;hydrogen peroxide;hydrochloride?
The canonical SMILES for benzene-1,2-diamine;hydrogen peroxide;hydrochloride is Cl.Nc1ccccc1N.OO.
What is the InChIKey of benzene-1,2-diamine;hydrogen peroxide;hydrochloride?
The InChIKey is XGAIUKFSSBMYFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.ClH.H2O2/c7-5-3-1-2-4-6(5)8;;1-2/h1-4H,7-8H2;1H;1-2H.
What are the key properties of benzene-1,2-diamine;hydrogen peroxide;hydrochloride?
benzene-1,2-diamine;hydrogen peroxide;hydrochloride has a molecular weight of 178.62 g/mol, XLogP of 1.29, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diamine;hydrogen peroxide;hydrochloride is sourced from PubChem (CID 175004407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).