About 2-aminophenol;azane
2-aminophenol;azane (PubChem CID 159865141) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is 2-aminophenol;azane.
Molecular Properties
| Compound Name | 2-aminophenol;azane |
| PubChem CID | 159865141 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 2-aminophenol;azane |
| SMILES | N.Nc1ccccc1O |
| InChI | InChI=1S/C6H7NO.H3N/c7-5-3-1-2-4-6(5)8;/h1-4,8H,7H2;1H3 |
| InChIKey | NRQGKJCYSBOWBS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-aminophenol;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminophenol;azane?
The IUPAC name of 2-aminophenol;azane (CID 159865141) is 2-aminophenol;azane.
What is the SMILES notation for 2-aminophenol;azane?
The canonical SMILES for 2-aminophenol;azane is N.Nc1ccccc1O.
What is the InChIKey of 2-aminophenol;azane?
The InChIKey is NRQGKJCYSBOWBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO.H3N/c7-5-3-1-2-4-6(5)8;/h1-4,8H,7H2;1H3.
What are the key properties of 2-aminophenol;azane?
2-aminophenol;azane has a molecular weight of 126.16 g/mol, XLogP of 1.14, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminophenol;azane is sourced from PubChem (CID 159865141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).