About 2-aminophenol;2-(2-aminophenoxy)aniline
2-aminophenol;2-(2-aminophenoxy)aniline (PubChem CID 174452334) has the molecular formula C18H19N3O2
and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-aminophenol;2-(2-aminophenoxy)aniline.
Molecular Properties
| Compound Name | 2-aminophenol;2-(2-aminophenoxy)aniline |
| PubChem CID | 174452334 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-aminophenol;2-(2-aminophenoxy)aniline |
| SMILES | Nc1ccccc1O.Nc1ccccc1Oc1ccccc1N |
| InChI | InChI=1S/C12H12N2O.C6H7NO/c13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14;7-5-3-1-2-4-6(5)8/h1-8H,13-14H2;1-4,8H,7H2 |
| InChIKey | DBHNHTAUFYENKR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-aminophenol;2-(2-aminophenoxy)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminophenol;2-(2-aminophenoxy)aniline?
The IUPAC name of 2-aminophenol;2-(2-aminophenoxy)aniline (CID 174452334) is 2-aminophenol;2-(2-aminophenoxy)aniline.
What is the SMILES notation for 2-aminophenol;2-(2-aminophenoxy)aniline?
The canonical SMILES for 2-aminophenol;2-(2-aminophenoxy)aniline is Nc1ccccc1O.Nc1ccccc1Oc1ccccc1N.
What is the InChIKey of 2-aminophenol;2-(2-aminophenoxy)aniline?
The InChIKey is DBHNHTAUFYENKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O.C6H7NO/c13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14;7-5-3-1-2-4-6(5)8/h1-8H,13-14H2;1-4,8H,7H2.
What are the key properties of 2-aminophenol;2-(2-aminophenoxy)aniline?
2-aminophenol;2-(2-aminophenoxy)aniline has a molecular weight of 309.37 g/mol, XLogP of 3.62, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminophenol;2-(2-aminophenoxy)aniline is sourced from PubChem (CID 174452334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).