About 2-aminophenol;ethane;methane
2-aminophenol;ethane;methane (PubChem CID 158189798) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is 2-aminophenol;ethane;methane.
Molecular Properties
| Compound Name | 2-aminophenol;ethane;methane |
| PubChem CID | 158189798 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 2-aminophenol;ethane;methane |
| SMILES | C.CC.Nc1ccccc1O |
| InChI | InChI=1S/C6H7NO.C2H6.CH4/c7-5-3-1-2-4-6(5)8;1-2;/h1-4,8H,7H2;1-2H3;1H4 |
| InChIKey | FZPJENPGLCOMKU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-aminophenol;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminophenol;ethane;methane?
The IUPAC name of 2-aminophenol;ethane;methane (CID 158189798) is 2-aminophenol;ethane;methane.
What is the SMILES notation for 2-aminophenol;ethane;methane?
The canonical SMILES for 2-aminophenol;ethane;methane is C.CC.Nc1ccccc1O.
What is the InChIKey of 2-aminophenol;ethane;methane?
The InChIKey is FZPJENPGLCOMKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO.C2H6.CH4/c7-5-3-1-2-4-6(5)8;1-2;/h1-4,8H,7H2;1-2H3;1H4.
What are the key properties of 2-aminophenol;ethane;methane?
2-aminophenol;ethane;methane has a molecular weight of 155.24 g/mol, XLogP of 2.64, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminophenol;ethane;methane is sourced from PubChem (CID 158189798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).