About 3-amino-2-fluorophenol;ethane
3-amino-2-fluorophenol;ethane (PubChem CID 155586440) has the molecular formula C8H12FNO
and a molecular weight of 157.19 g/mol. Its IUPAC name is 3-amino-2-fluorophenol;ethane.
Molecular Properties
| Compound Name | 3-amino-2-fluorophenol;ethane |
| PubChem CID | 155586440 |
| Molecular Formula | C8H12FNO |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 3-amino-2-fluorophenol;ethane |
| SMILES | CC.Nc1cccc(O)c1F |
| InChI | InChI=1S/C6H6FNO.C2H6/c7-6-4(8)2-1-3-5(6)9;1-2/h1-3,9H,8H2;1-2H3 |
| InChIKey | MRQIYOIPCZQKHH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-fluorophenol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-fluorophenol;ethane?
The IUPAC name of 3-amino-2-fluorophenol;ethane (CID 155586440) is 3-amino-2-fluorophenol;ethane.
What is the SMILES notation for 3-amino-2-fluorophenol;ethane?
The canonical SMILES for 3-amino-2-fluorophenol;ethane is CC.Nc1cccc(O)c1F.
What is the InChIKey of 3-amino-2-fluorophenol;ethane?
The InChIKey is MRQIYOIPCZQKHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FNO.C2H6/c7-6-4(8)2-1-3-5(6)9;1-2/h1-3,9H,8H2;1-2H3.
What are the key properties of 3-amino-2-fluorophenol;ethane?
3-amino-2-fluorophenol;ethane has a molecular weight of 157.19 g/mol, XLogP of 2.14, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-fluorophenol;ethane is sourced from PubChem (CID 155586440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).