C12H6F6O3 — CID 174546410
2,3-difluorophenol;2,3,5,6-tetrafluorobenzene-1,4-diol (PubChem CID 174546410) has the molecular formula C12H6F6O3 and a molecular weight of 312.17 g/mol. Its IUPAC name is 2,3-difluorophenol;2,3,5,6-tetrafluorobenzene-1,4-diol.
| Compound Name | 2,3-difluorophenol;2,3,5,6-tetrafluorobenzene-1,4-diol |
|---|---|
| PubChem CID | 174546410 |
| Molecular Formula | C12H6F6O3 |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 2,3-difluorophenol;2,3,5,6-tetrafluorobenzene-1,4-diol |
| SMILES | Oc1c(F)c(F)c(O)c(F)c1F.Oc1cccc(F)c1F |
| InChI | InChI=1S/C6H2F4O2.C6H4F2O/c7-1-2(8)6(12)4(10)3(9)5(1)11;7-4-2-1-3-5(9)6(4)8/h11-12H;1-3,9H |
| InChIKey | CNXLYJBQFKTYFG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|