About CID 155164288
CID 155164288 (PubChem CID 155164288) has the molecular formula C6H5FNaO
and a molecular weight of 135.09 g/mol.
Molecular Properties
| Compound Name | CID 155164288 |
| PubChem CID | 155164288 |
| Molecular Formula | C6H5FNaO |
| Molecular Weight | 135.09 g/mol |
| Exact Mass | 135.02 |
| IUPAC Name | — |
| SMILES | Oc1ccccc1F.[Na] |
| InChI | InChI=1S/C6H5FO.Na/c7-5-3-1-2-4-6(5)8;/h1-4,8H; |
| InChIKey | OMRDNLAPKRXART-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.09 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 155164288 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155164288?
The IUPAC name of CID 155164288 (CID 155164288) is not available.
What is the SMILES notation for CID 155164288?
The canonical SMILES for CID 155164288 is Oc1ccccc1F.[Na].
What is the InChIKey of CID 155164288?
The InChIKey is OMRDNLAPKRXART-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FO.Na/c7-5-3-1-2-4-6(5)8;/h1-4,8H;.
What are the key properties of CID 155164288?
CID 155164288 has a molecular weight of 135.09 g/mol, XLogP of 1.15, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155164288 is sourced from PubChem (CID 155164288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).