About ethane;2-fluorophenol;(4-methylphenyl)methanamine
ethane;2-fluorophenol;(4-methylphenyl)methanamine (PubChem CID 156804974) has the molecular formula C16H22FNO
and a molecular weight of 263.36 g/mol. Its IUPAC name is ethane;2-fluorophenol;(4-methylphenyl)methanamine.
Molecular Properties
| Compound Name | ethane;2-fluorophenol;(4-methylphenyl)methanamine |
| PubChem CID | 156804974 |
| Molecular Formula | C16H22FNO |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | ethane;2-fluorophenol;(4-methylphenyl)methanamine |
| SMILES | CC.Cc1ccc(CN)cc1.Oc1ccccc1F |
| InChI | InChI=1S/C8H11N.C6H5FO.C2H6/c1-7-2-4-8(6-9)5-3-7;7-5-3-1-2-4-6(5)8;1-2/h2-5H,6,9H2,1H3;1-4,8H;1-2H3 |
| InChIKey | OLVXVWMHAQOSGL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-fluorophenol;(4-methylphenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-fluorophenol;(4-methylphenyl)methanamine?
The IUPAC name of ethane;2-fluorophenol;(4-methylphenyl)methanamine (CID 156804974) is ethane;2-fluorophenol;(4-methylphenyl)methanamine.
What is the SMILES notation for ethane;2-fluorophenol;(4-methylphenyl)methanamine?
The canonical SMILES for ethane;2-fluorophenol;(4-methylphenyl)methanamine is CC.Cc1ccc(CN)cc1.Oc1ccccc1F.
What is the InChIKey of ethane;2-fluorophenol;(4-methylphenyl)methanamine?
The InChIKey is OLVXVWMHAQOSGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C6H5FO.C2H6/c1-7-2-4-8(6-9)5-3-7;7-5-3-1-2-4-6(5)8;1-2/h2-5H,6,9H2,1H3;1-4,8H;1-2H3.
What are the key properties of ethane;2-fluorophenol;(4-methylphenyl)methanamine?
ethane;2-fluorophenol;(4-methylphenyl)methanamine has a molecular weight of 263.36 g/mol, XLogP of 4.01, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-fluorophenol;(4-methylphenyl)methanamine is sourced from PubChem (CID 156804974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).