C6H4F2O2 — CID 10844515
2,4-difluorobenzene-1,3-diol (PubChem CID 10844515) has the molecular formula C6H4F2O2 and a molecular weight of 146.09 g/mol. Its IUPAC name is 2,4-difluorobenzene-1,3-diol.
| Compound Name | 2,4-difluorobenzene-1,3-diol |
|---|---|
| PubChem CID | 10844515 |
| Molecular Formula | C6H4F2O2 |
| Molecular Weight | 146.09 g/mol |
| Exact Mass | 146.02 |
| IUPAC Name | 2,4-difluorobenzene-1,3-diol |
| SMILES | Oc1ccc(F)c(O)c1F |
| InChI | InChI=1S/C6H4F2O2/c7-3-1-2-4(9)5(8)6(3)10/h1-2,9-10H |
| InChIKey | IBNBFQFUGXNAKU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.09 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |