C8H8F2O2 — CID 117277061
2,4-difluoro-3-(2-hydroxyethyl)phenol (PubChem CID 117277061) has the molecular formula C8H8F2O2 and a molecular weight of 174.15 g/mol. Its IUPAC name is 2,4-difluoro-3-(2-hydroxyethyl)phenol.
| Compound Name | 2,4-difluoro-3-(2-hydroxyethyl)phenol |
|---|---|
| PubChem CID | 117277061 |
| Molecular Formula | C8H8F2O2 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 2,4-difluoro-3-(2-hydroxyethyl)phenol |
| SMILES | OCCc1c(F)ccc(O)c1F |
| InChI | InChI=1S/C8H8F2O2/c9-6-1-2-7(12)8(10)5(6)3-4-11/h1-2,11-12H,3-4H2 |
| InChIKey | LIKKXYVMLQHNST-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |