C11H13F2NO2 — CID 126778749
2,4-difluoro-3-(morpholin-4-ylmethyl)phenol (PubChem CID 126778749) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is 2,4-difluoro-3-(morpholin-4-ylmethyl)phenol.
| Compound Name | 2,4-difluoro-3-(morpholin-4-ylmethyl)phenol |
|---|---|
| PubChem CID | 126778749 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2,4-difluoro-3-(morpholin-4-ylmethyl)phenol |
| SMILES | Oc1ccc(F)c(CN2CCOCC2)c1F |
| InChI | InChI=1S/C11H13F2NO2/c12-9-1-2-10(15)11(13)8(9)7-14-3-5-16-6-4-14/h1-2,15H,3-7H2 |
| InChIKey | YKZHVYHXQQBHJY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |