C18H15F3N2O3 — CID 136752915
7-(morpholin-4-ylmethyl)-3-(3,4,5-trifluorophenyl)-1,2-benzoxazol-6-ol (PubChem CID 136752915) has the molecular formula C18H15F3N2O3 and a molecular weight of 364.32 g/mol. Its IUPAC name is 7-(morpholin-4-ylmethyl)-3-(3,4,5-trifluorophenyl)-1,2-benzoxazol-6-ol.
| Compound Name | 7-(morpholin-4-ylmethyl)-3-(3,4,5-trifluorophenyl)-1,2-benzoxazol-6-ol |
|---|---|
| PubChem CID | 136752915 |
| Molecular Formula | C18H15F3N2O3 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 7-(morpholin-4-ylmethyl)-3-(3,4,5-trifluorophenyl)-1,2-benzoxazol-6-ol |
| SMILES | Oc1ccc2c(-c3cc(F)c(F)c(F)c3)noc2c1CN1CCOCC1 |
| InChI | InChI=1S/C18H15F3N2O3/c19-13-7-10(8-14(20)16(13)21)17-11-1-2-15(24)12(18(11)26-22-17)9-23-3-5-25-6-4-23/h1-2,7-8,24H,3-6,9H2 |
| InChIKey | OWAPNDAKKPTYHM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 58.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|