C19H18F3N3O2 — CID 136752942
7-[(4-methylpiperazin-1-yl)methyl]-3-(3,4,5-trifluorophenyl)-1,2-benzoxazol-6-ol (PubChem CID 136752942) has the molecular formula C19H18F3N3O2 and a molecular weight of 377.37 g/mol. Its IUPAC name is 7-[(4-methylpiperazin-1-yl)methyl]-3-(3,4,5-trifluorophenyl)-1,2-benzoxazol-6-ol.
| Compound Name | 7-[(4-methylpiperazin-1-yl)methyl]-3-(3,4,5-trifluorophenyl)-1,2-benzoxazol-6-ol |
|---|---|
| PubChem CID | 136752942 |
| Molecular Formula | C19H18F3N3O2 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 7-[(4-methylpiperazin-1-yl)methyl]-3-(3,4,5-trifluorophenyl)-1,2-benzoxazol-6-ol |
| SMILES | CN1CCN(Cc2c(O)ccc3c(-c4cc(F)c(F)c(F)c4)noc23)CC1 |
| InChI | InChI=1S/C19H18F3N3O2/c1-24-4-6-25(7-5-24)10-13-16(26)3-2-12-18(23-27-19(12)13)11-8-14(20)17(22)15(21)9-11/h2-3,8-9,26H,4-7,10H2,1H3 |
| InChIKey | VIDLXNGHUSUNID-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|